C26H20N4O3 — CID 19346328
3-(1,3-dioxoisoindol-2-yl)-N-[1-[(2-methylphenyl)methyl]pyrazol-4-yl]benzamide (PubChem CID 19346328) has the molecular formula C26H20N4O3 and a molecular weight of 436.47 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)-N-[1-[(2-methylphenyl)methyl]pyrazol-4-yl]benzamide.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)-N-[1-[(2-methylphenyl)methyl]pyrazol-4-yl]benzamide |
|---|---|
| PubChem CID | 19346328 |
| Molecular Formula | C26H20N4O3 |
| Molecular Weight | 436.47 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)-N-[1-[(2-methylphenyl)methyl]pyrazol-4-yl]benzamide |
| SMILES | Cc1ccccc1Cn1cc(NC(=O)c2cccc(N3C(=O)c4ccccc4C3=O)c2)cn1 |
| InChI | InChI=1S/C26H20N4O3/c1-17-7-2-3-8-19(17)15-29-16-20(14-27-29)28-24(31)18-9-6-10-21(13-18)30-25(32)22-11-4-5-12-23(22)26(30)33/h2-14,16H,15H2,1H3,(H,28,31) |
| InChIKey | GWXVNEGSLPWDQP-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.47 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|