C25H17FN4O3 — CID 19336412
3-(1,3-dioxoisoindol-2-yl)-N-[1-[(3-fluorophenyl)methyl]pyrazol-4-yl]benzamide (PubChem CID 19336412) has the molecular formula C25H17FN4O3 and a molecular weight of 440.43 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)-N-[1-[(3-fluorophenyl)methyl]pyrazol-4-yl]benzamide.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)-N-[1-[(3-fluorophenyl)methyl]pyrazol-4-yl]benzamide |
|---|---|
| PubChem CID | 19336412 |
| Molecular Formula | C25H17FN4O3 |
| Molecular Weight | 440.43 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)-N-[1-[(3-fluorophenyl)methyl]pyrazol-4-yl]benzamide |
| SMILES | O=C(Nc1cnn(Cc2cccc(F)c2)c1)c1cccc(N2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C25H17FN4O3/c26-18-7-3-5-16(11-18)14-29-15-19(13-27-29)28-23(31)17-6-4-8-20(12-17)30-24(32)21-9-1-2-10-22(21)25(30)33/h1-13,15H,14H2,(H,28,31) |
| InChIKey | IBQVPXTXWVHOKH-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.43 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|