C20H16FN5O2 — CID 46976116
N-[1-[(3-fluorophenyl)methyl]pyrazol-4-yl]-4-methyl-3-oxoquinoxaline-2-carboxamide (PubChem CID 46976116) has the molecular formula C20H16FN5O2 and a molecular weight of 377.38 g/mol. Its IUPAC name is N-[1-[(3-fluorophenyl)methyl]pyrazol-4-yl]-4-methyl-3-oxoquinoxaline-2-carboxamide.
| Compound Name | N-[1-[(3-fluorophenyl)methyl]pyrazol-4-yl]-4-methyl-3-oxoquinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 46976116 |
| Molecular Formula | C20H16FN5O2 |
| Molecular Weight | 377.38 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | N-[1-[(3-fluorophenyl)methyl]pyrazol-4-yl]-4-methyl-3-oxoquinoxaline-2-carboxamide |
| SMILES | Cn1c(=O)c(C(=O)Nc2cnn(Cc3cccc(F)c3)c2)nc2ccccc21 |
| InChI | InChI=1S/C20H16FN5O2/c1-25-17-8-3-2-7-16(17)24-18(20(25)28)19(27)23-15-10-22-26(12-15)11-13-5-4-6-14(21)9-13/h2-10,12H,11H2,1H3,(H,23,27) |
| InChIKey | OTTZDTCZNFDADD-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.38 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |