C15H13FIN5O — CID 19262034
N-[1-[(3-fluorophenyl)methyl]pyrazol-4-yl]-4-iodo-1-methylpyrazole-3-carboxamide (PubChem CID 19262034) has the molecular formula C15H13FIN5O and a molecular weight of 425.21 g/mol. Its IUPAC name is N-[1-[(3-fluorophenyl)methyl]pyrazol-4-yl]-4-iodo-1-methylpyrazole-3-carboxamide.
| Compound Name | N-[1-[(3-fluorophenyl)methyl]pyrazol-4-yl]-4-iodo-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19262034 |
| Molecular Formula | C15H13FIN5O |
| Molecular Weight | 425.21 g/mol |
| Exact Mass | 425.01 |
| IUPAC Name | N-[1-[(3-fluorophenyl)methyl]pyrazol-4-yl]-4-iodo-1-methylpyrazole-3-carboxamide |
| SMILES | Cn1cc(I)c(C(=O)Nc2cnn(Cc3cccc(F)c3)c2)n1 |
| InChI | InChI=1S/C15H13FIN5O/c1-21-9-13(17)14(20-21)15(23)19-12-6-18-22(8-12)7-10-3-2-4-11(16)5-10/h2-6,8-9H,7H2,1H3,(H,19,23) |
| InChIKey | HXIQBRFQNHBFLQ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.21 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|