C18H19N7O4 — CID 19336553
N-(1,5-dimethylpyrazol-4-yl)-1-methyl-4-[(4-methyl-3-nitrobenzoyl)amino]pyrazole-5-carboxamide (PubChem CID 19336553) has the molecular formula C18H19N7O4 and a molecular weight of 397.40 g/mol. Its IUPAC name is N-(1,5-dimethylpyrazol-4-yl)-1-methyl-4-[(4-methyl-3-nitrobenzoyl)amino]pyrazole-5-carboxamide.
| Compound Name | N-(1,5-dimethylpyrazol-4-yl)-1-methyl-4-[(4-methyl-3-nitrobenzoyl)amino]pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19336553 |
| Molecular Formula | C18H19N7O4 |
| Molecular Weight | 397.40 g/mol |
| Exact Mass | 397.15 |
| IUPAC Name | N-(1,5-dimethylpyrazol-4-yl)-1-methyl-4-[(4-methyl-3-nitrobenzoyl)amino]pyrazole-5-carboxamide |
| SMILES | Cc1ccc(C(=O)Nc2cnn(C)c2C(=O)Nc2cnn(C)c2C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H19N7O4/c1-10-5-6-12(7-15(10)25(28)29)17(26)22-14-9-20-24(4)16(14)18(27)21-13-8-19-23(3)11(13)2/h5-9H,1-4H3,(H,21,27)(H,22,26) |
| InChIKey | MFIZAWUFUDVFOY-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 136.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.40 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|