C12H9N5O7 — CID 19406015
4-[(3,5-dinitrobenzoyl)amino]-1-methylpyrazole-5-carboxylic acid (PubChem CID 19406015) has the molecular formula C12H9N5O7 and a molecular weight of 335.23 g/mol. Its IUPAC name is 4-[(3,5-dinitrobenzoyl)amino]-1-methylpyrazole-5-carboxylic acid.
| Compound Name | 4-[(3,5-dinitrobenzoyl)amino]-1-methylpyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 19406015 |
| Molecular Formula | C12H9N5O7 |
| Molecular Weight | 335.23 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | 4-[(3,5-dinitrobenzoyl)amino]-1-methylpyrazole-5-carboxylic acid |
| SMILES | Cn1ncc(NC(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)c1C(=O)O |
| InChI | InChI=1S/C12H9N5O7/c1-15-10(12(19)20)9(5-13-15)14-11(18)6-2-7(16(21)22)4-8(3-6)17(23)24/h2-5H,1H3,(H,14,18)(H,19,20) |
| InChIKey | ZDXSPSHGGXKMSB-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 170.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.23 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|