C23H23ClN2O3 — CID 11947227
3-[(3aS,5S,7aS)-5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-(3-chloro-2-methylphenyl)benzamide (PubChem CID 11947227) has the molecular formula C23H23ClN2O3 and a molecular weight of 410.90 g/mol. Its IUPAC name is 3-[(3aS,5S,7aS)-5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-(3-chloro-2-methylphenyl)benzamide.
| Compound Name | 3-[(3aS,5S,7aS)-5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-(3-chloro-2-methylphenyl)benzamide |
|---|---|
| PubChem CID | 11947227 |
| Molecular Formula | C23H23ClN2O3 |
| Molecular Weight | 410.90 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 3-[(3aS,5S,7aS)-5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-(3-chloro-2-methylphenyl)benzamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)c1cccc(N2C(=O)[C@H]3CC[C@H](C)C[C@@H]3C2=O)c1 |
| InChI | InChI=1S/C23H23ClN2O3/c1-13-9-10-17-18(11-13)23(29)26(22(17)28)16-6-3-5-15(12-16)21(27)25-20-8-4-7-19(24)14(20)2/h3-8,12-13,17-18H,9-11H2,1-2H3,(H,25,27)/t13-,17-,18-/m0/s1 |
| InChIKey | SGYKQRVHIGMOCR-KKXDTOCCSA-N |
| XLogP | 4.83 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.90 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|