C23H24N2O3 — CID 11902574
N-[3-[(3aS,5R,7aR)-5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]phenyl]-4-methylbenzamide (PubChem CID 11902574) has the molecular formula C23H24N2O3 and a molecular weight of 376.46 g/mol. Its IUPAC name is N-[3-[(3aS,5R,7aR)-5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]phenyl]-4-methylbenzamide.
| Compound Name | N-[3-[(3aS,5R,7aR)-5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]phenyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 11902574 |
| Molecular Formula | C23H24N2O3 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | N-[3-[(3aS,5R,7aR)-5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]phenyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2cccc(N3C(=O)[C@H]4C[C@H](C)CC[C@H]4C3=O)c2)cc1 |
| InChI | InChI=1S/C23H24N2O3/c1-14-6-9-16(10-7-14)21(26)24-17-4-3-5-18(13-17)25-22(27)19-11-8-15(2)12-20(19)23(25)28/h3-7,9-10,13,15,19-20H,8,11-12H2,1-2H3,(H,24,26)/t15-,19-,20+/m1/s1 |
| InChIKey | HMQHUXKCAGDWOY-YSGRDPCXSA-N |
| XLogP | 4.17 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|