C23H23NO4 — CID 7297980
[4-[(3aR,5S,7aR)-5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]phenyl] 4-methylbenzoate (PubChem CID 7297980) has the molecular formula C23H23NO4 and a molecular weight of 377.44 g/mol. Its IUPAC name is [4-[(3aR,5S,7aR)-5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]phenyl] 4-methylbenzoate.
| Compound Name | [4-[(3aR,5S,7aR)-5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]phenyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 7297980 |
| Molecular Formula | C23H23NO4 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | [4-[(3aR,5S,7aR)-5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]phenyl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2ccc(N3C(=O)[C@@H]4CC[C@H](C)C[C@H]4C3=O)cc2)cc1 |
| InChI | InChI=1S/C23H23NO4/c1-14-3-6-16(7-4-14)23(27)28-18-10-8-17(9-11-18)24-21(25)19-12-5-15(2)13-20(19)22(24)26/h3-4,6-11,15,19-20H,5,12-13H2,1-2H3/t15-,19+,20+/m0/s1 |
| InChIKey | PZRSGUPWTNJKHN-CWFSZBLJSA-N |
| XLogP | 4.14 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|