C30H27NO6 — CID 5015349
[4-[2-[4-(5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenoxy]acetyl]phenyl] benzoate (PubChem CID 5015349) has the molecular formula C30H27NO6 and a molecular weight of 497.55 g/mol. Its IUPAC name is [4-[2-[4-(5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenoxy]acetyl]phenyl] benzoate.
| Compound Name | [4-[2-[4-(5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenoxy]acetyl]phenyl] benzoate |
|---|---|
| PubChem CID | 5015349 |
| Molecular Formula | C30H27NO6 |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | [4-[2-[4-(5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)phenoxy]acetyl]phenyl] benzoate |
| SMILES | CC1CCC2C(=O)N(c3ccc(OCC(=O)c4ccc(OC(=O)c5ccccc5)cc4)cc3)C(=O)C2C1 |
| InChI | InChI=1S/C30H27NO6/c1-19-7-16-25-26(17-19)29(34)31(28(25)33)22-10-14-23(15-11-22)36-18-27(32)20-8-12-24(13-9-20)37-30(35)21-5-3-2-4-6-21/h2-6,8-15,19,25-26H,7,16-18H2,1H3 |
| InChIKey | RJFYFHWNZOQVOT-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|