C33H31NO7 — CID 19645819
[4-[2-[2-(5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-3-phenylpropanoyl]oxyacetyl]phenyl] benzoate (PubChem CID 19645819) has the molecular formula C33H31NO7 and a molecular weight of 553.61 g/mol. Its IUPAC name is [4-[2-[2-(5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-3-phenylpropanoyl]oxyacetyl]phenyl] benzoate.
| Compound Name | [4-[2-[2-(5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-3-phenylpropanoyl]oxyacetyl]phenyl] benzoate |
|---|---|
| PubChem CID | 19645819 |
| Molecular Formula | C33H31NO7 |
| Molecular Weight | 553.61 g/mol |
| Exact Mass | 553.21 |
| IUPAC Name | [4-[2-[2-(5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-3-phenylpropanoyl]oxyacetyl]phenyl] benzoate |
| SMILES | CC1CCC2C(=O)N(C(Cc3ccccc3)C(=O)OCC(=O)c3ccc(OC(=O)c4ccccc4)cc3)C(=O)C2C1 |
| InChI | InChI=1S/C33H31NO7/c1-21-12-17-26-27(18-21)31(37)34(30(26)36)28(19-22-8-4-2-5-9-22)33(39)40-20-29(35)23-13-15-25(16-14-23)41-32(38)24-10-6-3-7-11-24/h2-11,13-16,21,26-28H,12,17-20H2,1H3 |
| InChIKey | RZXFAEUOYFQOMH-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.61 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|