C27H27NO8 — CID 19645857
[4-[2-[2-(5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetyl]oxyacetyl]phenyl] 3-methoxybenzoate (PubChem CID 19645857) has the molecular formula C27H27NO8 and a molecular weight of 493.51 g/mol. Its IUPAC name is [4-[2-[2-(5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetyl]oxyacetyl]phenyl] 3-methoxybenzoate.
| Compound Name | [4-[2-[2-(5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetyl]oxyacetyl]phenyl] 3-methoxybenzoate |
|---|---|
| PubChem CID | 19645857 |
| Molecular Formula | C27H27NO8 |
| Molecular Weight | 493.51 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | [4-[2-[2-(5-methyl-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)acetyl]oxyacetyl]phenyl] 3-methoxybenzoate |
| SMILES | COc1cccc(C(=O)Oc2ccc(C(=O)COC(=O)CN3C(=O)C4CCC(C)CC4C3=O)cc2)c1 |
| InChI | InChI=1S/C27H27NO8/c1-16-6-11-21-22(12-16)26(32)28(25(21)31)14-24(30)35-15-23(29)17-7-9-19(10-8-17)36-27(33)18-4-3-5-20(13-18)34-2/h3-5,7-10,13,16,21-22H,6,11-12,14-15H2,1-2H3 |
| InChIKey | LSRDJSCKYZTQNA-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 116.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.51 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|