C32H27NO8 — CID 19645583
[2-[4-(3-methoxybenzoyl)oxyphenyl]-2-oxoethyl] 3-(4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)benzoate (PubChem CID 19645583) has the molecular formula C32H27NO8 and a molecular weight of 553.57 g/mol. Its IUPAC name is [2-[4-(3-methoxybenzoyl)oxyphenyl]-2-oxoethyl] 3-(4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)benzoate.
| Compound Name | [2-[4-(3-methoxybenzoyl)oxyphenyl]-2-oxoethyl] 3-(4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)benzoate |
|---|---|
| PubChem CID | 19645583 |
| Molecular Formula | C32H27NO8 |
| Molecular Weight | 553.57 g/mol |
| Exact Mass | 553.17 |
| IUPAC Name | [2-[4-(3-methoxybenzoyl)oxyphenyl]-2-oxoethyl] 3-(4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)benzoate |
| SMILES | COc1cccc(C(=O)Oc2ccc(C(=O)COC(=O)c3cccc(N4C(=O)C5CC=CC(C)C5C4=O)c3)cc2)c1 |
| InChI | InChI=1S/C32H27NO8/c1-19-6-3-11-26-28(19)30(36)33(29(26)35)23-9-4-7-21(16-23)31(37)40-18-27(34)20-12-14-24(15-13-20)41-32(38)22-8-5-10-25(17-22)39-2/h3-10,12-17,19,26,28H,11,18H2,1-2H3 |
| InChIKey | COZZQHOFXMNMRU-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 116.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.57 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|