C25H23NO6 — CID 2924966
[2-(4-methoxyphenyl)-2-oxoethyl] 3-(4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)benzoate (PubChem CID 2924966) has the molecular formula C25H23NO6 and a molecular weight of 433.46 g/mol. Its IUPAC name is [2-(4-methoxyphenyl)-2-oxoethyl] 3-(4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)benzoate.
| Compound Name | [2-(4-methoxyphenyl)-2-oxoethyl] 3-(4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)benzoate |
|---|---|
| PubChem CID | 2924966 |
| Molecular Formula | C25H23NO6 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | [2-(4-methoxyphenyl)-2-oxoethyl] 3-(4-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)benzoate |
| SMILES | COc1ccc(C(=O)COC(=O)c2cccc(N3C(=O)C4CC=CC(C)C4C3=O)c2)cc1 |
| InChI | InChI=1S/C25H23NO6/c1-15-5-3-8-20-22(15)24(29)26(23(20)28)18-7-4-6-17(13-18)25(30)32-14-21(27)16-9-11-19(31-2)12-10-16/h3-7,9-13,15,20,22H,8,14H2,1-2H3 |
| InChIKey | JXWPNABMPCXMNW-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|