C38H31NO8 — CID 124718418
[4-[2-[4-[(1R,2R,6R,7R,8S)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoyl]oxyacetyl]phenyl] 3-methoxybenzoate (PubChem CID 124718418) has the molecular formula C38H31NO8 and a molecular weight of 629.67 g/mol. Its IUPAC name is [4-[2-[4-[(1R,2R,6R,7R,8S)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoyl]oxyacetyl]phenyl] 3-methoxybenzoate.
| Compound Name | [4-[2-[4-[(1R,2R,6R,7R,8S)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoyl]oxyacetyl]phenyl] 3-methoxybenzoate |
|---|---|
| PubChem CID | 124718418 |
| Molecular Formula | C38H31NO8 |
| Molecular Weight | 629.67 g/mol |
| Exact Mass | 629.20 |
| IUPAC Name | [4-[2-[4-[(1R,2R,6R,7R,8S)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoyl]oxyacetyl]phenyl] 3-methoxybenzoate |
| SMILES | COc1cccc(C(=O)Oc2ccc(C(=O)COC(=O)c3ccc(N4C(=O)[C@@H]5[C@@H]6C[C@@H]([C@H]5C4=O)[C@@H](c4ccccc4)C6)cc3)cc2)c1 |
| InChI | InChI=1S/C38H31NO8/c1-45-29-9-5-8-25(18-29)38(44)47-28-16-12-23(13-17-28)32(40)21-46-37(43)24-10-14-27(15-11-24)39-35(41)33-26-19-30(22-6-3-2-4-7-22)31(20-26)34(33)36(39)42/h2-18,26,30-31,33-34H,19-21H2,1H3/t26-,30+,31+,33+,34+/m0/s1 |
| InChIKey | BZZBMBXIQKFEHR-KONZKVLOSA-N |
| XLogP | 5.88 |
| TPSA | 116.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.67 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|