C37H27Cl2NO7 — CID 124714507
[4-[2-[4-[(1R,2R,6S,7R,8S)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoyl]oxyacetyl]phenyl] 2,4-dichlorobenzoate (PubChem CID 124714507) has the molecular formula C37H27Cl2NO7 and a molecular weight of 668.53 g/mol. Its IUPAC name is [4-[2-[4-[(1R,2R,6S,7R,8S)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoyl]oxyacetyl]phenyl] 2,4-dichlorobenzoate.
| Compound Name | [4-[2-[4-[(1R,2R,6S,7R,8S)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoyl]oxyacetyl]phenyl] 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 124714507 |
| Molecular Formula | C37H27Cl2NO7 |
| Molecular Weight | 668.53 g/mol |
| Exact Mass | 667.12 |
| IUPAC Name | [4-[2-[4-[(1R,2R,6S,7R,8S)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoyl]oxyacetyl]phenyl] 2,4-dichlorobenzoate |
| SMILES | O=C(COC(=O)c1ccc(N2C(=O)[C@@H]3[C@@H]4C[C@@H]([C@@H]3C2=O)[C@@H](c2ccccc2)C4)cc1)c1ccc(OC(=O)c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C37H27Cl2NO7/c38-24-10-15-27(30(39)18-24)37(45)47-26-13-8-21(9-14-26)31(41)19-46-36(44)22-6-11-25(12-7-22)40-34(42)32-23-16-28(20-4-2-1-3-5-20)29(17-23)33(32)35(40)43/h1-15,18,23,28-29,32-33H,16-17,19H2/t23-,28+,29+,32+,33-/m0/s1 |
| InChIKey | LCIYNLSCYFRWIP-MFOMSKBDSA-N |
| XLogP | 7.18 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.53 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|