C35H27NO8 — CID 124714566
[4-[2-[4-[(1R,2R,6S,7R,8S)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoyl]oxyacetyl]phenyl] furan-2-carboxylate (PubChem CID 124714566) has the molecular formula C35H27NO8 and a molecular weight of 589.60 g/mol. Its IUPAC name is [4-[2-[4-[(1R,2R,6S,7R,8S)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoyl]oxyacetyl]phenyl] furan-2-carboxylate.
| Compound Name | [4-[2-[4-[(1R,2R,6S,7R,8S)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoyl]oxyacetyl]phenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 124714566 |
| Molecular Formula | C35H27NO8 |
| Molecular Weight | 589.60 g/mol |
| Exact Mass | 589.17 |
| IUPAC Name | [4-[2-[4-[(1R,2R,6S,7R,8S)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoyl]oxyacetyl]phenyl] furan-2-carboxylate |
| SMILES | O=C(COC(=O)c1ccc(N2C(=O)[C@@H]3[C@@H]4C[C@@H]([C@@H]3C2=O)[C@@H](c2ccccc2)C4)cc1)c1ccc(OC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C35H27NO8/c37-28(21-10-14-25(15-11-21)44-35(41)29-7-4-16-42-29)19-43-34(40)22-8-12-24(13-9-22)36-32(38)30-23-17-26(20-5-2-1-3-6-20)27(18-23)31(30)33(36)39/h1-16,23,26-27,30-31H,17-19H2/t23-,26+,27+,30+,31-/m0/s1 |
| InChIKey | MHULCWKWNHRBNJ-XIFLLLQFSA-N |
| XLogP | 5.47 |
| TPSA | 120.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.60 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|