C36H28N2O8 — CID 98281066
[2-[4-(4-nitrophenoxy)phenyl]-2-oxoethyl] 4-[(1R,2R,6R,7R,8R)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoate (PubChem CID 98281066) has the molecular formula C36H28N2O8 and a molecular weight of 616.63 g/mol. Its IUPAC name is [2-[4-(4-nitrophenoxy)phenyl]-2-oxoethyl] 4-[(1R,2R,6R,7R,8R)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoate.
| Compound Name | [2-[4-(4-nitrophenoxy)phenyl]-2-oxoethyl] 4-[(1R,2R,6R,7R,8R)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoate |
|---|---|
| PubChem CID | 98281066 |
| Molecular Formula | C36H28N2O8 |
| Molecular Weight | 616.63 g/mol |
| Exact Mass | 616.18 |
| IUPAC Name | [2-[4-(4-nitrophenoxy)phenyl]-2-oxoethyl] 4-[(1R,2R,6R,7R,8R)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoate |
| SMILES | O=C(COC(=O)c1ccc(N2C(=O)[C@@H]3[C@@H]4C[C@@H]([C@H]3C2=O)[C@H](c2ccccc2)C4)cc1)c1ccc(Oc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C36H28N2O8/c39-31(22-8-14-27(15-9-22)46-28-16-12-26(13-17-28)38(43)44)20-45-36(42)23-6-10-25(11-7-23)37-34(40)32-24-18-29(21-4-2-1-3-5-21)30(19-24)33(32)35(37)41/h1-17,24,29-30,32-33H,18-20H2/t24-,29-,30+,32+,33+/m0/s1 |
| InChIKey | LEJPFFYPVREWFB-QBXGXDJLSA-N |
| XLogP | 6.36 |
| TPSA | 133.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.63 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|