C28H23NO5S — CID 98183593
(2-oxo-2-thiophen-2-ylethyl) 4-[(1S,2R,6R,7S,8R)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoate (PubChem CID 98183593) has the molecular formula C28H23NO5S and a molecular weight of 485.56 g/mol. Its IUPAC name is (2-oxo-2-thiophen-2-ylethyl) 4-[(1S,2R,6R,7S,8R)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoate.
| Compound Name | (2-oxo-2-thiophen-2-ylethyl) 4-[(1S,2R,6R,7S,8R)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoate |
|---|---|
| PubChem CID | 98183593 |
| Molecular Formula | C28H23NO5S |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | (2-oxo-2-thiophen-2-ylethyl) 4-[(1S,2R,6R,7S,8R)-3,5-dioxo-8-phenyl-4-azatricyclo[5.2.1.02,6]decan-4-yl]benzoate |
| SMILES | O=C(OCC(=O)c1cccs1)c1ccc(N2C(=O)[C@@H]3[C@H]4C[C@H]([C@H]3C2=O)[C@H](c2ccccc2)C4)cc1 |
| InChI | InChI=1S/C28H23NO5S/c30-22(23-7-4-12-35-23)15-34-28(33)17-8-10-19(11-9-17)29-26(31)24-18-13-20(16-5-2-1-3-6-16)21(14-18)25(24)27(29)32/h1-12,18,20-21,24-25H,13-15H2/t18-,20+,21+,24-,25-/m1/s1 |
| InChIKey | MJOWBVKOBKJGCX-TUYRMQEDSA-N |
| XLogP | 4.72 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|