C20H23NO6 — CID 7906667
[2-(4-ethoxyphenyl)-2-oxoethyl] 2-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]acetate (PubChem CID 7906667) has the molecular formula C20H23NO6 and a molecular weight of 373.41 g/mol. Its IUPAC name is [2-(4-ethoxyphenyl)-2-oxoethyl] 2-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]acetate.
| Compound Name | [2-(4-ethoxyphenyl)-2-oxoethyl] 2-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]acetate |
|---|---|
| PubChem CID | 7906667 |
| Molecular Formula | C20H23NO6 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | [2-(4-ethoxyphenyl)-2-oxoethyl] 2-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]acetate |
| SMILES | CCOc1ccc(C(=O)COC(=O)CN2C(=O)[C@@H]3CCCC[C@H]3C2=O)cc1 |
| InChI | InChI=1S/C20H23NO6/c1-2-26-14-9-7-13(8-10-14)17(22)12-27-18(23)11-21-19(24)15-5-3-4-6-16(15)20(21)25/h7-10,15-16H,2-6,11-12H2,1H3/t15-,16-/m1/s1 |
| InChIKey | XJEPMIPKRZZVBY-HZPDHXFCSA-N |
| XLogP | 1.99 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|