C19H22N2O6 — CID 7821480
[2-(4-ethoxyphenyl)-2-oxoethyl] 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate (PubChem CID 7821480) has the molecular formula C19H22N2O6 and a molecular weight of 374.39 g/mol. Its IUPAC name is [2-(4-ethoxyphenyl)-2-oxoethyl] 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate.
| Compound Name | [2-(4-ethoxyphenyl)-2-oxoethyl] 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate |
|---|---|
| PubChem CID | 7821480 |
| Molecular Formula | C19H22N2O6 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | [2-(4-ethoxyphenyl)-2-oxoethyl] 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate |
| SMILES | CCOc1ccc(C(=O)COC(=O)CN2C(=O)NC3(CCCC3)C2=O)cc1 |
| InChI | InChI=1S/C19H22N2O6/c1-2-26-14-7-5-13(6-8-14)15(22)12-27-16(23)11-21-17(24)19(20-18(21)25)9-3-4-10-19/h5-8H,2-4,9-12H2,1H3,(H,20,25) |
| InChIKey | LRNFGPZMSKDORR-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|