C17H16Cl2N2O5 — CID 42983006
[2-(3,4-dichlorophenyl)-2-oxoethyl] 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate (PubChem CID 42983006) has the molecular formula C17H16Cl2N2O5 and a molecular weight of 399.23 g/mol. Its IUPAC name is [2-(3,4-dichlorophenyl)-2-oxoethyl] 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate.
| Compound Name | [2-(3,4-dichlorophenyl)-2-oxoethyl] 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate |
|---|---|
| PubChem CID | 42983006 |
| Molecular Formula | C17H16Cl2N2O5 |
| Molecular Weight | 399.23 g/mol |
| Exact Mass | 398.04 |
| IUPAC Name | [2-(3,4-dichlorophenyl)-2-oxoethyl] 2-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)acetate |
| SMILES | O=C(CN1C(=O)NC2(CCCC2)C1=O)OCC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H16Cl2N2O5/c18-11-4-3-10(7-12(11)19)13(22)9-26-14(23)8-21-15(24)17(20-16(21)25)5-1-2-6-17/h3-4,7H,1-2,5-6,8-9H2,(H,20,25) |
| InChIKey | HIQBYXGDQAMKRO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.23 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|