C20H23FN2O6 — CID 47094308
[2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl] 2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate (PubChem CID 47094308) has the molecular formula C20H23FN2O6 and a molecular weight of 406.41 g/mol. Its IUPAC name is [2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl] 2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate.
| Compound Name | [2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl] 2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate |
|---|---|
| PubChem CID | 47094308 |
| Molecular Formula | C20H23FN2O6 |
| Molecular Weight | 406.41 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | [2-(3-fluoro-4-methoxyphenyl)-2-oxoethyl] 2-(8-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate |
| SMILES | COc1ccc(C(=O)COC(=O)CN2C(=O)NC3(CCC(C)CC3)C2=O)cc1F |
| InChI | InChI=1S/C20H23FN2O6/c1-12-5-7-20(8-6-12)18(26)23(19(27)22-20)10-17(25)29-11-15(24)13-3-4-16(28-2)14(21)9-13/h3-4,9,12H,5-8,10-11H2,1-2H3,(H,22,27) |
| InChIKey | PSEVXNJBQFXZPN-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.41 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|