C23H30N4O8 — CID 55311750
[2-[2-(3,4-dimethoxybenzoyl)hydrazinyl]-2-oxoethyl] 2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate (PubChem CID 55311750) has the molecular formula C23H30N4O8 and a molecular weight of 490.51 g/mol. Its IUPAC name is [2-[2-(3,4-dimethoxybenzoyl)hydrazinyl]-2-oxoethyl] 2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate.
| Compound Name | [2-[2-(3,4-dimethoxybenzoyl)hydrazinyl]-2-oxoethyl] 2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate |
|---|---|
| PubChem CID | 55311750 |
| Molecular Formula | C23H30N4O8 |
| Molecular Weight | 490.51 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | [2-[2-(3,4-dimethoxybenzoyl)hydrazinyl]-2-oxoethyl] 2-(8-ethyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate |
| SMILES | CCC1CCC2(CC1)NC(=O)N(CC(=O)OCC(=O)NNC(=O)c1ccc(OC)c(OC)c1)C2=O |
| InChI | InChI=1S/C23H30N4O8/c1-4-14-7-9-23(10-8-14)21(31)27(22(32)24-23)12-19(29)35-13-18(28)25-26-20(30)15-5-6-16(33-2)17(11-15)34-3/h5-6,11,14H,4,7-10,12-13H2,1-3H3,(H,24,32)(H,25,28)(H,26,30) |
| InChIKey | JUUYQQZNLKYVOD-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 152.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.51 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|