C21H22N6O6 — CID 55426867
[2-[2-(3,4-dimethoxybenzoyl)hydrazinyl]-2-oxoethyl] 2-[5-(4-methylphenyl)tetrazol-2-yl]acetate (PubChem CID 55426867) has the molecular formula C21H22N6O6 and a molecular weight of 454.44 g/mol. Its IUPAC name is [2-[2-(3,4-dimethoxybenzoyl)hydrazinyl]-2-oxoethyl] 2-[5-(4-methylphenyl)tetrazol-2-yl]acetate.
| Compound Name | [2-[2-(3,4-dimethoxybenzoyl)hydrazinyl]-2-oxoethyl] 2-[5-(4-methylphenyl)tetrazol-2-yl]acetate |
|---|---|
| PubChem CID | 55426867 |
| Molecular Formula | C21H22N6O6 |
| Molecular Weight | 454.44 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | [2-[2-(3,4-dimethoxybenzoyl)hydrazinyl]-2-oxoethyl] 2-[5-(4-methylphenyl)tetrazol-2-yl]acetate |
| SMILES | COc1ccc(C(=O)NNC(=O)COC(=O)Cn2nnc(-c3ccc(C)cc3)n2)cc1OC |
| InChI | InChI=1S/C21H22N6O6/c1-13-4-6-14(7-5-13)20-23-26-27(25-20)11-19(29)33-12-18(28)22-24-21(30)15-8-9-16(31-2)17(10-15)32-3/h4-10H,11-12H2,1-3H3,(H,22,28)(H,24,30) |
| InChIKey | VGAZFQPYXYQRQS-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 146.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.44 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|