C17H23N5O3 — CID 8825589
[2-oxo-2-(pentan-3-ylamino)ethyl] 2-[5-(4-methylphenyl)tetrazol-2-yl]acetate (PubChem CID 8825589) has the molecular formula C17H23N5O3 and a molecular weight of 345.40 g/mol. Its IUPAC name is [2-oxo-2-(pentan-3-ylamino)ethyl] 2-[5-(4-methylphenyl)tetrazol-2-yl]acetate.
| Compound Name | [2-oxo-2-(pentan-3-ylamino)ethyl] 2-[5-(4-methylphenyl)tetrazol-2-yl]acetate |
|---|---|
| PubChem CID | 8825589 |
| Molecular Formula | C17H23N5O3 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | [2-oxo-2-(pentan-3-ylamino)ethyl] 2-[5-(4-methylphenyl)tetrazol-2-yl]acetate |
| SMILES | CCC(CC)NC(=O)COC(=O)Cn1nnc(-c2ccc(C)cc2)n1 |
| InChI | InChI=1S/C17H23N5O3/c1-4-14(5-2)18-15(23)11-25-16(24)10-22-20-17(19-21-22)13-8-6-12(3)7-9-13/h6-9,14H,4-5,10-11H2,1-3H3,(H,18,23) |
| InChIKey | NVFUZSDQSNFTLY-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |