C13H15N5O3 — CID 7713038
ethyl N-[2-[5-(4-methylphenyl)tetrazol-2-yl]acetyl]carbamate (PubChem CID 7713038) has the molecular formula C13H15N5O3 and a molecular weight of 289.30 g/mol. Its IUPAC name is ethyl N-[2-[5-(4-methylphenyl)tetrazol-2-yl]acetyl]carbamate.
| Compound Name | ethyl N-[2-[5-(4-methylphenyl)tetrazol-2-yl]acetyl]carbamate |
|---|---|
| PubChem CID | 7713038 |
| Molecular Formula | C13H15N5O3 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | ethyl N-[2-[5-(4-methylphenyl)tetrazol-2-yl]acetyl]carbamate |
| SMILES | CCOC(=O)NC(=O)Cn1nnc(-c2ccc(C)cc2)n1 |
| InChI | InChI=1S/C13H15N5O3/c1-3-21-13(20)14-11(19)8-18-16-12(15-17-18)10-6-4-9(2)5-7-10/h4-7H,3,8H2,1-2H3,(H,14,19,20) |
| InChIKey | PVJZVKHNJOJEBO-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |