C16H14BrN5O3S — CID 36610131
ethyl 2-[[2-[5-(4-bromophenyl)tetrazol-2-yl]acetyl]amino]thiophene-3-carboxylate (PubChem CID 36610131) has the molecular formula C16H14BrN5O3S and a molecular weight of 436.29 g/mol. Its IUPAC name is ethyl 2-[[2-[5-(4-bromophenyl)tetrazol-2-yl]acetyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-[5-(4-bromophenyl)tetrazol-2-yl]acetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 36610131 |
| Molecular Formula | C16H14BrN5O3S |
| Molecular Weight | 436.29 g/mol |
| Exact Mass | 435.00 |
| IUPAC Name | ethyl 2-[[2-[5-(4-bromophenyl)tetrazol-2-yl]acetyl]amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1ccsc1NC(=O)Cn1nnc(-c2ccc(Br)cc2)n1 |
| InChI | InChI=1S/C16H14BrN5O3S/c1-2-25-16(24)12-7-8-26-15(12)18-13(23)9-22-20-14(19-21-22)10-3-5-11(17)6-4-10/h3-8H,2,9H2,1H3,(H,18,23) |
| InChIKey | MXMKIXOABMVULZ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.29 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |