C12H14N4O3S — CID 61118419
ethyl 2-[[2-(4-aminopyrazol-1-yl)acetyl]amino]thiophene-3-carboxylate (PubChem CID 61118419) has the molecular formula C12H14N4O3S and a molecular weight of 294.34 g/mol. Its IUPAC name is ethyl 2-[[2-(4-aminopyrazol-1-yl)acetyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-(4-aminopyrazol-1-yl)acetyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 61118419 |
| Molecular Formula | C12H14N4O3S |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | ethyl 2-[[2-(4-aminopyrazol-1-yl)acetyl]amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1ccsc1NC(=O)Cn1cc(N)cn1 |
| InChI | InChI=1S/C12H14N4O3S/c1-2-19-12(18)9-3-4-20-11(9)15-10(17)7-16-6-8(13)5-14-16/h3-6H,2,7,13H2,1H3,(H,15,17) |
| InChIKey | QHWJRTKQPNNWIR-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |