C10H13NO5S — CID 79345757
ethyl 2-(2-hydroxyethoxycarbonylamino)thiophene-3-carboxylate (PubChem CID 79345757) has the molecular formula C10H13NO5S and a molecular weight of 259.28 g/mol. Its IUPAC name is ethyl 2-(2-hydroxyethoxycarbonylamino)thiophene-3-carboxylate.
| Compound Name | ethyl 2-(2-hydroxyethoxycarbonylamino)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 79345757 |
| Molecular Formula | C10H13NO5S |
| Molecular Weight | 259.28 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | ethyl 2-(2-hydroxyethoxycarbonylamino)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1ccsc1NC(=O)OCCO |
| InChI | InChI=1S/C10H13NO5S/c1-2-15-9(13)7-3-6-17-8(7)11-10(14)16-5-4-12/h3,6,12H,2,4-5H2,1H3,(H,11,14) |
| InChIKey | PEZBMQBAPGWIAP-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.28 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |