C10H12BrNO3S — CID 115571598
ethyl 2-(3-bromopropanoylamino)thiophene-3-carboxylate (PubChem CID 115571598) has the molecular formula C10H12BrNO3S and a molecular weight of 306.18 g/mol. Its IUPAC name is ethyl 2-(3-bromopropanoylamino)thiophene-3-carboxylate.
| Compound Name | ethyl 2-(3-bromopropanoylamino)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 115571598 |
| Molecular Formula | C10H12BrNO3S |
| Molecular Weight | 306.18 g/mol |
| Exact Mass | 304.97 |
| IUPAC Name | ethyl 2-(3-bromopropanoylamino)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1ccsc1NC(=O)CCBr |
| InChI | InChI=1S/C10H12BrNO3S/c1-2-15-10(14)7-4-6-16-9(7)12-8(13)3-5-11/h4,6H,2-3,5H2,1H3,(H,12,13) |
| InChIKey | QCNILZZHHLEJIC-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.18 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|