C11H14N2O4S — CID 60660981
ethyl 4-[(3-carbamoylthiophen-2-yl)amino]-4-oxobutanoate (PubChem CID 60660981) has the molecular formula C11H14N2O4S and a molecular weight of 270.31 g/mol. Its IUPAC name is ethyl 4-[(3-carbamoylthiophen-2-yl)amino]-4-oxobutanoate.
| Compound Name | ethyl 4-[(3-carbamoylthiophen-2-yl)amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 60660981 |
| Molecular Formula | C11H14N2O4S |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | ethyl 4-[(3-carbamoylthiophen-2-yl)amino]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)Nc1sccc1C(N)=O |
| InChI | InChI=1S/C11H14N2O4S/c1-2-17-9(15)4-3-8(14)13-11-7(10(12)16)5-6-18-11/h5-6H,2-4H2,1H3,(H2,12,16)(H,13,14) |
| InChIKey | NROYXUSLVGXYAZ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |