C7H10N2OS — CID 63089344
2-(ethylamino)thiophene-3-carboxamide (PubChem CID 63089344) has the molecular formula C7H10N2OS and a molecular weight of 170.24 g/mol. Its IUPAC name is 2-(ethylamino)thiophene-3-carboxamide.
| Compound Name | 2-(ethylamino)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 63089344 |
| Molecular Formula | C7H10N2OS |
| Molecular Weight | 170.24 g/mol |
| Exact Mass | 170.05 |
| IUPAC Name | 2-(ethylamino)thiophene-3-carboxamide |
| SMILES | CCNc1sccc1C(N)=O |
| InChI | InChI=1S/C7H10N2OS/c1-2-9-7-5(6(8)10)3-4-11-7/h3-4,9H,2H2,1H3,(H2,8,10) |
| InChIKey | PDJKAEWCHLQCLF-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.24 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |