C11H13N3O6S — CID 63646484
2-[[2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl]-(carboxymethyl)amino]acetic acid (PubChem CID 63646484) has the molecular formula C11H13N3O6S and a molecular weight of 315.31 g/mol. Its IUPAC name is 2-[[2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl]-(carboxymethyl)amino]acetic acid.
| Compound Name | 2-[[2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl]-(carboxymethyl)amino]acetic acid |
|---|---|
| PubChem CID | 63646484 |
| Molecular Formula | C11H13N3O6S |
| Molecular Weight | 315.31 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | 2-[[2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl]-(carboxymethyl)amino]acetic acid |
| SMILES | NC(=O)c1ccsc1NC(=O)CN(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C11H13N3O6S/c12-10(20)6-1-2-21-11(6)13-7(15)3-14(4-8(16)17)5-9(18)19/h1-2H,3-5H2,(H2,12,20)(H,13,15)(H,16,17)(H,18,19) |
| InChIKey | SACYZYIQBLQFES-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 150.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.31 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |