C7H9N3O2S — CID 60641622
2-[(2-aminoacetyl)amino]thiophene-3-carboxamide (PubChem CID 60641622) has the molecular formula C7H9N3O2S and a molecular weight of 199.24 g/mol. Its IUPAC name is 2-[(2-aminoacetyl)amino]thiophene-3-carboxamide.
| Compound Name | 2-[(2-aminoacetyl)amino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 60641622 |
| Molecular Formula | C7H9N3O2S |
| Molecular Weight | 199.24 g/mol |
| Exact Mass | 199.04 |
| IUPAC Name | 2-[(2-aminoacetyl)amino]thiophene-3-carboxamide |
| SMILES | NCC(=O)Nc1sccc1C(N)=O |
| InChI | InChI=1S/C7H9N3O2S/c8-3-5(11)10-7-4(6(9)12)1-2-13-7/h1-2H,3,8H2,(H2,9,12)(H,10,11) |
| InChIKey | OJRSAWXJTLHXEC-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.24 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |