About 2-[[2-[2,2-difluoroethyl(2-hydroxyethyl)amino]acetyl]amino]thiophene-3-carboxamide
2-[[2-[2,2-difluoroethyl(2-hydroxyethyl)amino]acetyl]amino]thiophene-3-carboxamide (PubChem CID 107485683) has the molecular formula C11H15F2N3O3S
and a molecular weight of 307.32 g/mol. Its IUPAC name is 2-[[2-[2,2-difluoroethyl(2-hydroxyethyl)amino]acetyl]amino]thiophene-3-carboxamide.
Molecular Properties
| Compound Name | 2-[[2-[2,2-difluoroethyl(2-hydroxyethyl)amino]acetyl]amino]thiophene-3-carboxamide |
| PubChem CID | 107485683 |
| Molecular Formula | C11H15F2N3O3S |
| Molecular Weight | 307.32 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | 2-[[2-[2,2-difluoroethyl(2-hydroxyethyl)amino]acetyl]amino]thiophene-3-carboxamide |
| SMILES | NC(=O)c1ccsc1NC(=O)CN(CCO)CC(F)F |
| InChI | InChI=1S/C11H15F2N3O3S/c12-8(13)5-16(2-3-17)6-9(18)15-11-7(10(14)19)1-4-20-11/h1,4,8,17H,2-3,5-6H2,(H2,14,19)(H,15,18) |
| InChIKey | DIPOWDJOSLZYOF-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.32 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[[2-[2,2-difluoroethyl(2-hydroxyethyl)amino]acetyl]amino]thiophene-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-[2,2-difluoroethyl(2-hydroxyethyl)amino]acetyl]amino]thiophene-3-carboxamide?
The IUPAC name of 2-[[2-[2,2-difluoroethyl(2-hydroxyethyl)amino]acetyl]amino]thiophene-3-carboxamide (CID 107485683) is 2-[[2-[2,2-difluoroethyl(2-hydroxyethyl)amino]acetyl]amino]thiophene-3-carboxamide.
What is the SMILES notation for 2-[[2-[2,2-difluoroethyl(2-hydroxyethyl)amino]acetyl]amino]thiophene-3-carboxamide?
The canonical SMILES for 2-[[2-[2,2-difluoroethyl(2-hydroxyethyl)amino]acetyl]amino]thiophene-3-carboxamide is NC(=O)c1ccsc1NC(=O)CN(CCO)CC(F)F.
What is the InChIKey of 2-[[2-[2,2-difluoroethyl(2-hydroxyethyl)amino]acetyl]amino]thiophene-3-carboxamide?
The InChIKey is DIPOWDJOSLZYOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15F2N3O3S/c12-8(13)5-16(2-3-17)6-9(18)15-11-7(10(14)19)1-4-20-11/h1,4,8,17H,2-3,5-6H2,(H2,14,19)(H,15,18).
What are the key properties of 2-[[2-[2,2-difluoroethyl(2-hydroxyethyl)amino]acetyl]amino]thiophene-3-carboxamide?
2-[[2-[2,2-difluoroethyl(2-hydroxyethyl)amino]acetyl]amino]thiophene-3-carboxamide has a molecular weight of 307.32 g/mol, XLogP of 0.34, 8 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-[2,2-difluoroethyl(2-hydroxyethyl)amino]acetyl]amino]thiophene-3-carboxamide is sourced from PubChem (CID 107485683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).