C12H16ClF2N3O2 — CID 107478609
N-(2-amino-4-chlorophenyl)-2-[2,2-difluoroethyl(2-hydroxyethyl)amino]acetamide (PubChem CID 107478609) has the molecular formula C12H16ClF2N3O2 and a molecular weight of 307.73 g/mol. Its IUPAC name is N-(2-amino-4-chlorophenyl)-2-[2,2-difluoroethyl(2-hydroxyethyl)amino]acetamide.
| Compound Name | N-(2-amino-4-chlorophenyl)-2-[2,2-difluoroethyl(2-hydroxyethyl)amino]acetamide |
|---|---|
| PubChem CID | 107478609 |
| Molecular Formula | C12H16ClF2N3O2 |
| Molecular Weight | 307.73 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | N-(2-amino-4-chlorophenyl)-2-[2,2-difluoroethyl(2-hydroxyethyl)amino]acetamide |
| SMILES | Nc1cc(Cl)ccc1NC(=O)CN(CCO)CC(F)F |
| InChI | InChI=1S/C12H16ClF2N3O2/c13-8-1-2-10(9(16)5-8)17-12(20)7-18(3-4-19)6-11(14)15/h1-2,5,11,19H,3-4,6-7,16H2,(H,17,20) |
| InChIKey | XDRXGSNBESETHF-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.73 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|