C12H19N3O3 — CID 61242990
N-(2-aminophenyl)-2-[bis(2-hydroxyethyl)amino]acetamide (PubChem CID 61242990) has the molecular formula C12H19N3O3 and a molecular weight of 253.30 g/mol. Its IUPAC name is N-(2-aminophenyl)-2-[bis(2-hydroxyethyl)amino]acetamide.
| Compound Name | N-(2-aminophenyl)-2-[bis(2-hydroxyethyl)amino]acetamide |
|---|---|
| PubChem CID | 61242990 |
| Molecular Formula | C12H19N3O3 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.14 |
| IUPAC Name | N-(2-aminophenyl)-2-[bis(2-hydroxyethyl)amino]acetamide |
| SMILES | Nc1ccccc1NC(=O)CN(CCO)CCO |
| InChI | InChI=1S/C12H19N3O3/c13-10-3-1-2-4-11(10)14-12(18)9-15(5-7-16)6-8-17/h1-4,16-17H,5-9,13H2,(H,14,18) |
| InChIKey | FWLTUGWLAVBTLB-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|