C12H16Cl2N2O3 — CID 18870879
2-[bis(2-hydroxyethyl)amino]-N-(2,4-dichlorophenyl)acetamide (PubChem CID 18870879) has the molecular formula C12H16Cl2N2O3 and a molecular weight of 307.18 g/mol. Its IUPAC name is 2-[bis(2-hydroxyethyl)amino]-N-(2,4-dichlorophenyl)acetamide.
| Compound Name | 2-[bis(2-hydroxyethyl)amino]-N-(2,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 18870879 |
| Molecular Formula | C12H16Cl2N2O3 |
| Molecular Weight | 307.18 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | 2-[bis(2-hydroxyethyl)amino]-N-(2,4-dichlorophenyl)acetamide |
| SMILES | O=C(CN(CCO)CCO)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H16Cl2N2O3/c13-9-1-2-11(10(14)7-9)15-12(19)8-16(3-5-17)4-6-18/h1-2,7,17-18H,3-6,8H2,(H,15,19) |
| InChIKey | UDIQSOQGOGWMRG-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.18 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |