C15H20Cl2N2O3 — CID 119134576
4-[[2-(2,4-dichloroanilino)-2-oxoethyl]-propylamino]butanoic acid (PubChem CID 119134576) has the molecular formula C15H20Cl2N2O3 and a molecular weight of 347.24 g/mol. Its IUPAC name is 4-[[2-(2,4-dichloroanilino)-2-oxoethyl]-propylamino]butanoic acid.
| Compound Name | 4-[[2-(2,4-dichloroanilino)-2-oxoethyl]-propylamino]butanoic acid |
|---|---|
| PubChem CID | 119134576 |
| Molecular Formula | C15H20Cl2N2O3 |
| Molecular Weight | 347.24 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 4-[[2-(2,4-dichloroanilino)-2-oxoethyl]-propylamino]butanoic acid |
| SMILES | CCCN(CCCC(=O)O)CC(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H20Cl2N2O3/c1-2-7-19(8-3-4-15(21)22)10-14(20)18-13-6-5-11(16)9-12(13)17/h5-6,9H,2-4,7-8,10H2,1H3,(H,18,20)(H,21,22) |
| InChIKey | DGRZJXMALYRILF-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.24 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |