C15H19Cl2F3N2O2 — CID 112838785
N-(2,4-dichlorophenyl)-2-[propyl-[2-(2,2,2-trifluoroethoxy)ethyl]amino]acetamide (PubChem CID 112838785) has the molecular formula C15H19Cl2F3N2O2 and a molecular weight of 387.23 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-2-[propyl-[2-(2,2,2-trifluoroethoxy)ethyl]amino]acetamide.
| Compound Name | N-(2,4-dichlorophenyl)-2-[propyl-[2-(2,2,2-trifluoroethoxy)ethyl]amino]acetamide |
|---|---|
| PubChem CID | 112838785 |
| Molecular Formula | C15H19Cl2F3N2O2 |
| Molecular Weight | 387.23 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | N-(2,4-dichlorophenyl)-2-[propyl-[2-(2,2,2-trifluoroethoxy)ethyl]amino]acetamide |
| SMILES | CCCN(CCOCC(F)(F)F)CC(=O)Nc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H19Cl2F3N2O2/c1-2-5-22(6-7-24-10-15(18,19)20)9-14(23)21-13-4-3-11(16)8-12(13)17/h3-4,8H,2,5-7,9-10H2,1H3,(H,21,23) |
| InChIKey | BLSOASPANLKMKZ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.23 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|