C13H20N2O4 — CID 18870897
2-[bis(2-hydroxyethyl)amino]-N-(2-methoxyphenyl)acetamide (PubChem CID 18870897) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is 2-[bis(2-hydroxyethyl)amino]-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-[bis(2-hydroxyethyl)amino]-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 18870897 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 2-[bis(2-hydroxyethyl)amino]-N-(2-methoxyphenyl)acetamide |
| SMILES | COc1ccccc1NC(=O)CN(CCO)CCO |
| InChI | InChI=1S/C13H20N2O4/c1-19-12-5-3-2-4-11(12)14-13(18)10-15(6-8-16)7-9-17/h2-5,16-17H,6-10H2,1H3,(H,14,18) |
| InChIKey | FQVUYTOSNULTAC-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |