C11H17N3O2S — CID 55121254
2-[3-(ethylamino)butanoylamino]thiophene-3-carboxamide (PubChem CID 55121254) has the molecular formula C11H17N3O2S and a molecular weight of 255.34 g/mol. Its IUPAC name is 2-[3-(ethylamino)butanoylamino]thiophene-3-carboxamide.
| Compound Name | 2-[3-(ethylamino)butanoylamino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 55121254 |
| Molecular Formula | C11H17N3O2S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 2-[3-(ethylamino)butanoylamino]thiophene-3-carboxamide |
| SMILES | CCNC(C)CC(=O)Nc1sccc1C(N)=O |
| InChI | InChI=1S/C11H17N3O2S/c1-3-13-7(2)6-9(15)14-11-8(10(12)16)4-5-17-11/h4-5,7,13H,3,6H2,1-2H3,(H2,12,16)(H,14,15) |
| InChIKey | XKPWFKDXGJASLE-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |