C17H20FN3O2S — CID 9133741
2-[[2-[[(1R)-1-(4-fluorophenyl)-2-methylpropyl]amino]acetyl]amino]thiophene-3-carboxamide (PubChem CID 9133741) has the molecular formula C17H20FN3O2S and a molecular weight of 349.43 g/mol. Its IUPAC name is 2-[[2-[[(1R)-1-(4-fluorophenyl)-2-methylpropyl]amino]acetyl]amino]thiophene-3-carboxamide.
| Compound Name | 2-[[2-[[(1R)-1-(4-fluorophenyl)-2-methylpropyl]amino]acetyl]amino]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 9133741 |
| Molecular Formula | C17H20FN3O2S |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 2-[[2-[[(1R)-1-(4-fluorophenyl)-2-methylpropyl]amino]acetyl]amino]thiophene-3-carboxamide |
| SMILES | CC(C)[C@@H](NCC(=O)Nc1sccc1C(N)=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H20FN3O2S/c1-10(2)15(11-3-5-12(18)6-4-11)20-9-14(22)21-17-13(16(19)23)7-8-24-17/h3-8,10,15,20H,9H2,1-2H3,(H2,19,23)(H,21,22)/t15-/m1/s1 |
| InChIKey | WDCPHQTYLUQOSA-OAHLLOKOSA-N |
| XLogP | 2.91 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |