C7H10N2O4S2 — CID 112573422
ethyl 2-(sulfamoylamino)thiophene-3-carboxylate (PubChem CID 112573422) has the molecular formula C7H10N2O4S2 and a molecular weight of 250.30 g/mol. Its IUPAC name is ethyl 2-(sulfamoylamino)thiophene-3-carboxylate.
| Compound Name | ethyl 2-(sulfamoylamino)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 112573422 |
| Molecular Formula | C7H10N2O4S2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.01 |
| IUPAC Name | ethyl 2-(sulfamoylamino)thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1ccsc1NS(N)(=O)=O |
| InChI | InChI=1S/C7H10N2O4S2/c1-2-13-7(10)5-3-4-14-6(5)9-15(8,11)12/h3-4,9H,2H2,1H3,(H2,8,11,12) |
| InChIKey | XQMNOCDMNUBYIW-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |