C17H15N5O5 — CID 55460162
[2-(furan-2-carbonylamino)-2-oxoethyl] 2-[5-(4-methylphenyl)tetrazol-2-yl]acetate (PubChem CID 55460162) has the molecular formula C17H15N5O5 and a molecular weight of 369.34 g/mol. Its IUPAC name is [2-(furan-2-carbonylamino)-2-oxoethyl] 2-[5-(4-methylphenyl)tetrazol-2-yl]acetate.
| Compound Name | [2-(furan-2-carbonylamino)-2-oxoethyl] 2-[5-(4-methylphenyl)tetrazol-2-yl]acetate |
|---|---|
| PubChem CID | 55460162 |
| Molecular Formula | C17H15N5O5 |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | [2-(furan-2-carbonylamino)-2-oxoethyl] 2-[5-(4-methylphenyl)tetrazol-2-yl]acetate |
| SMILES | Cc1ccc(-c2nnn(CC(=O)OCC(=O)NC(=O)c3ccco3)n2)cc1 |
| InChI | InChI=1S/C17H15N5O5/c1-11-4-6-12(7-5-11)16-19-21-22(20-16)9-15(24)27-10-14(23)18-17(25)13-3-2-8-26-13/h2-8H,9-10H2,1H3,(H,18,23,25) |
| InChIKey | YOBRIRGBTVIBCB-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 129.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |