C17H15NO7 — CID 24558117
[2-(furan-2-carbonylamino)-2-oxoethyl] 2-(4-acetylphenoxy)acetate (PubChem CID 24558117) has the molecular formula C17H15NO7 and a molecular weight of 345.31 g/mol. Its IUPAC name is [2-(furan-2-carbonylamino)-2-oxoethyl] 2-(4-acetylphenoxy)acetate.
| Compound Name | [2-(furan-2-carbonylamino)-2-oxoethyl] 2-(4-acetylphenoxy)acetate |
|---|---|
| PubChem CID | 24558117 |
| Molecular Formula | C17H15NO7 |
| Molecular Weight | 345.31 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | [2-(furan-2-carbonylamino)-2-oxoethyl] 2-(4-acetylphenoxy)acetate |
| SMILES | CC(=O)c1ccc(OCC(=O)OCC(=O)NC(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C17H15NO7/c1-11(19)12-4-6-13(7-5-12)24-10-16(21)25-9-15(20)18-17(22)14-3-2-8-23-14/h2-8H,9-10H2,1H3,(H,18,20,22) |
| InChIKey | ADFFWEPHROKVKP-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.31 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |