C15H18N2O6 — CID 8806365
[2-[[2-(methylamino)-2-oxoethyl]amino]-2-oxoethyl] 2-(4-acetylphenoxy)acetate (PubChem CID 8806365) has the molecular formula C15H18N2O6 and a molecular weight of 322.32 g/mol. Its IUPAC name is [2-[[2-(methylamino)-2-oxoethyl]amino]-2-oxoethyl] 2-(4-acetylphenoxy)acetate.
| Compound Name | [2-[[2-(methylamino)-2-oxoethyl]amino]-2-oxoethyl] 2-(4-acetylphenoxy)acetate |
|---|---|
| PubChem CID | 8806365 |
| Molecular Formula | C15H18N2O6 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | [2-[[2-(methylamino)-2-oxoethyl]amino]-2-oxoethyl] 2-(4-acetylphenoxy)acetate |
| SMILES | CNC(=O)CNC(=O)COC(=O)COc1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C15H18N2O6/c1-10(18)11-3-5-12(6-4-11)22-9-15(21)23-8-14(20)17-7-13(19)16-2/h3-6H,7-9H2,1-2H3,(H,16,19)(H,17,20) |
| InChIKey | LZULTYVEOAYSHG-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |