C19H19NO7S — CID 8638261
[2-(2-methylsulfonylanilino)-2-oxoethyl] 2-(4-acetylphenoxy)acetate (PubChem CID 8638261) has the molecular formula C19H19NO7S and a molecular weight of 405.43 g/mol. Its IUPAC name is [2-(2-methylsulfonylanilino)-2-oxoethyl] 2-(4-acetylphenoxy)acetate.
| Compound Name | [2-(2-methylsulfonylanilino)-2-oxoethyl] 2-(4-acetylphenoxy)acetate |
|---|---|
| PubChem CID | 8638261 |
| Molecular Formula | C19H19NO7S |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | [2-(2-methylsulfonylanilino)-2-oxoethyl] 2-(4-acetylphenoxy)acetate |
| SMILES | CC(=O)c1ccc(OCC(=O)OCC(=O)Nc2ccccc2S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C19H19NO7S/c1-13(21)14-7-9-15(10-8-14)26-12-19(23)27-11-18(22)20-16-5-3-4-6-17(16)28(2,24)25/h3-10H,11-12H2,1-2H3,(H,20,22) |
| InChIKey | YSSFHZXBBCZDJB-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |