C21H25NO6S — CID 9309760
[2-(2-methylsulfonylanilino)-2-oxoethyl] 2-(2-tert-butylphenoxy)acetate (PubChem CID 9309760) has the molecular formula C21H25NO6S and a molecular weight of 419.50 g/mol. Its IUPAC name is [2-(2-methylsulfonylanilino)-2-oxoethyl] 2-(2-tert-butylphenoxy)acetate.
| Compound Name | [2-(2-methylsulfonylanilino)-2-oxoethyl] 2-(2-tert-butylphenoxy)acetate |
|---|---|
| PubChem CID | 9309760 |
| Molecular Formula | C21H25NO6S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | [2-(2-methylsulfonylanilino)-2-oxoethyl] 2-(2-tert-butylphenoxy)acetate |
| SMILES | CC(C)(C)c1ccccc1OCC(=O)OCC(=O)Nc1ccccc1S(C)(=O)=O |
| InChI | InChI=1S/C21H25NO6S/c1-21(2,3)15-9-5-7-11-17(15)27-14-20(24)28-13-19(23)22-16-10-6-8-12-18(16)29(4,25)26/h5-12H,13-14H2,1-4H3,(H,22,23) |
| InChIKey | GNLOIJHNXSKNHU-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |